C21H43NO2Sn — CID 10972577
tert-butyl (2S)-2-tributylstannylpyrrolidine-1-carboxylate (PubChem CID 10972577) has the molecular formula C21H43NO2Sn and a molecular weight of 460.29 g/mol. Its IUPAC name is tert-butyl (2S)-2-tributylstannylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-tributylstannylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10972577 |
| Molecular Formula | C21H43NO2Sn |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | tert-butyl (2S)-2-tributylstannylpyrrolidine-1-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H16NO2.3C4H9.Sn/c1-9(2,3)12-8(11)10-6-4-5-7-10;3*1-3-4-2;/h6H,4-5,7H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | PZUXJSXENZTXMP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |