C23H45NO2Sn — CID 154077880
tert-butyl (2S)-2-(2-tributylstannylethenyl)pyrrolidine-1-carboxylate (PubChem CID 154077880) has the molecular formula C23H45NO2Sn and a molecular weight of 486.33 g/mol. Its IUPAC name is tert-butyl (2S)-2-(2-tributylstannylethenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(2-tributylstannylethenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154077880 |
| Molecular Formula | C23H45NO2Sn |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | tert-butyl (2S)-2-(2-tributylstannylethenyl)pyrrolidine-1-carboxylate |
| SMILES | CCCC[Sn](C=C[C@@H]1CCCN1C(=O)OC(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C11H18NO2.3C4H9.Sn/c1-5-9-7-6-8-12(9)10(13)14-11(2,3)4;3*1-3-4-2;/h1,5,9H,6-8H2,2-4H3;3*1,3-4H2,2H3;/t9-;;;;/m1..../s1 |
| InChIKey | XHYGJFWCIPUKFL-RASHCQHBSA-N |
| XLogP | 7.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |