C30H33N2Na2O3P3 — CID 10974092
disodium;N',N'-bis(diphenylphosphanylmethyl)-N-(2-phosphonatoethyl)ethane-1,2-diamine (PubChem CID 10974092) has the molecular formula C30H33N2Na2O3P3 and a molecular weight of 608.51 g/mol. Its IUPAC name is disodium;N',N'-bis(diphenylphosphanylmethyl)-N-(2-phosphonatoethyl)ethane-1,2-diamine.
| Compound Name | disodium;N',N'-bis(diphenylphosphanylmethyl)-N-(2-phosphonatoethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 10974092 |
| Molecular Formula | C30H33N2Na2O3P3 |
| Molecular Weight | 608.51 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | disodium;N',N'-bis(diphenylphosphanylmethyl)-N-(2-phosphonatoethyl)ethane-1,2-diamine |
| SMILES | O=P([O-])([O-])CCNCCN(CP(c1ccccc1)c1ccccc1)CP(c1ccccc1)c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C30H35N2O3P3.2Na/c33-38(34,35)24-22-31-21-23-32(25-36(27-13-5-1-6-14-27)28-15-7-2-8-16-28)26-37(29-17-9-3-10-18-29)30-19-11-4-12-20-30;;/h1-20,31H,21-26H2,(H2,33,34,35);;/q;2*+1/p-2 |
| InChIKey | NVVNGSMVXQIXNE-UHFFFAOYSA-L |
| XLogP | -3.02 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.51 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|