C45H48N7O6P3 — CID 90390049
1-[2-[bis[2-(diphenylphosphanyloxycarbamoylamino)ethyl]amino]ethyl]-3-diphenylphosphanyloxyurea (PubChem CID 90390049) has the molecular formula C45H48N7O6P3 and a molecular weight of 875.84 g/mol. Its IUPAC name is 1-[2-[bis[2-(diphenylphosphanyloxycarbamoylamino)ethyl]amino]ethyl]-3-diphenylphosphanyloxyurea.
| Compound Name | 1-[2-[bis[2-(diphenylphosphanyloxycarbamoylamino)ethyl]amino]ethyl]-3-diphenylphosphanyloxyurea |
|---|---|
| PubChem CID | 90390049 |
| Molecular Formula | C45H48N7O6P3 |
| Molecular Weight | 875.84 g/mol |
| Exact Mass | 875.29 |
| IUPAC Name | 1-[2-[bis[2-(diphenylphosphanyloxycarbamoylamino)ethyl]amino]ethyl]-3-diphenylphosphanyloxyurea |
| SMILES | O=C(NCCN(CCNC(=O)NOP(c1ccccc1)c1ccccc1)CCNC(=O)NOP(c1ccccc1)c1ccccc1)NOP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H48N7O6P3/c53-43(49-56-59(37-19-7-1-8-20-37)38-21-9-2-10-22-38)46-31-34-52(35-32-47-44(54)50-57-60(39-23-11-3-12-24-39)40-25-13-4-14-26-40)36-33-48-45(55)51-58-61(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-30H,31-36H2,(H2,46,49,53)(H2,47,50,54)(H2,48,51,55) |
| InChIKey | FYOUCCIKSXOQRQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 154.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|