C6H9N3O4S — CID 10976952
(3aR,5S,7aS)-5-azido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2,2-dioxide (PubChem CID 10976952) has the molecular formula C6H9N3O4S and a molecular weight of 219.22 g/mol. Its IUPAC name is (3aR,5S,7aS)-5-azido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2,2-dioxide.
| Compound Name | (3aR,5S,7aS)-5-azido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2,2-dioxide |
|---|---|
| PubChem CID | 10976952 |
| Molecular Formula | C6H9N3O4S |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | (3aR,5S,7aS)-5-azido-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2,2-dioxide |
| SMILES | [N-]=[N+]=N[C@H]1CC[C@@H]2OS(=O)(=O)O[C@@H]2C1 |
| InChI | InChI=1S/C6H9N3O4S/c7-9-8-4-1-2-5-6(3-4)13-14(10,11)12-5/h4-6H,1-3H2/t4-,5-,6+/m0/s1 |
| InChIKey | RZVUTVHDWDSFRE-HCWXCVPCSA-N |
| XLogP | 0.88 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|