C14H22O3 — CID 10977499
(2R,3S)-3,7-dimethyl-2-[(3S)-5-oxooxolan-3-yl]oct-6-enal (PubChem CID 10977499) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2R,3S)-3,7-dimethyl-2-[(3S)-5-oxooxolan-3-yl]oct-6-enal.
| Compound Name | (2R,3S)-3,7-dimethyl-2-[(3S)-5-oxooxolan-3-yl]oct-6-enal |
|---|---|
| PubChem CID | 10977499 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2R,3S)-3,7-dimethyl-2-[(3S)-5-oxooxolan-3-yl]oct-6-enal |
| SMILES | CC(C)=CCC[C@H](C)[C@@H](C=O)[C@H]1COC(=O)C1 |
| InChI | InChI=1S/C14H22O3/c1-10(2)5-4-6-11(3)13(8-15)12-7-14(16)17-9-12/h5,8,11-13H,4,6-7,9H2,1-3H3/t11-,12+,13+/m0/s1 |
| InChIKey | MVJDRFZQZDJUCO-YNEHKIRRSA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|