C29H54O6Si — CID 10984233
(1S,2R,5R,6R,7S,8R,9S,12S,13S,17R)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,5,6,8,12,15,15,17-octamethyl-10-methylidene-4,14,16-trioxabicyclo[11.3.1]heptadecan-3-one (PubChem CID 10984233) has the molecular formula C29H54O6Si and a molecular weight of 526.83 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S,8R,9S,12S,13S,17R)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,5,6,8,12,15,15,17-octamethyl-10-methylidene-4,14,16-trioxabicyclo[11.3.1]heptadecan-3-one.
| Compound Name | (1S,2R,5R,6R,7S,8R,9S,12S,13S,17R)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,5,6,8,12,15,15,17-octamethyl-10-methylidene-4,14,16-trioxabicyclo[11.3.1]heptadecan-3-one |
|---|---|
| PubChem CID | 10984233 |
| Molecular Formula | C29H54O6Si |
| Molecular Weight | 526.83 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | (1S,2R,5R,6R,7S,8R,9S,12S,13S,17R)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,5,6,8,12,15,15,17-octamethyl-10-methylidene-4,14,16-trioxabicyclo[11.3.1]heptadecan-3-one |
| SMILES | C=C1C[C@H](C)[C@@H]2OC(C)(C)O[C@@H]([C@@H]2C)[C@@H](C)C(=O)O[C@H](C)[C@H](C)[C@H](O)[C@@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O6Si/c1-16-15-17(2)25(35-36(13,14)28(8,9)10)19(4)23(30)18(3)22(7)32-27(31)21(6)26-20(5)24(16)33-29(11,12)34-26/h16,18-26,30H,2,15H2,1,3-14H3/t16-,18-,19+,20+,21+,22+,23-,24-,25+,26-/m0/s1 |
| InChIKey | XIOVCAFFNQIBAS-APVMWBIGSA-N |
| XLogP | 6.33 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.83 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|