C7H15ClN2O5 — CID 10988473
[(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium perchlorate (PubChem CID 10988473) has the molecular formula C7H15ClN2O5 and a molecular weight of 242.66 g/mol. Its IUPAC name is [(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium perchlorate.
| Compound Name | [(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium perchlorate |
|---|---|
| PubChem CID | 10988473 |
| Molecular Formula | C7H15ClN2O5 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | [(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium perchlorate |
| SMILES | C[N+](C)(C)C[C@@H](O)CC#N.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C7H15N2O.ClHO4/c1-9(2,3)6-7(10)4-5-8;2-1(3,4)5/h7,10H,4,6H2,1-3H3;(H,2,3,4,5)/q+1;/p-1/t7-;/m0./s1 |
| InChIKey | AERNMUZNSJCIMK-FJXQXJEOSA-M |
| XLogP | -4.79 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|