C16H30ClNOSi — CID 10990704
tert-butyl-(5-chloro-4-pyrrolidin-1-ylcyclohex-3-en-1-yl)oxy-dimethylsilane (PubChem CID 10990704) has the molecular formula C16H30ClNOSi and a molecular weight of 315.96 g/mol. Its IUPAC name is tert-butyl-(5-chloro-4-pyrrolidin-1-ylcyclohex-3-en-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(5-chloro-4-pyrrolidin-1-ylcyclohex-3-en-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 10990704 |
| Molecular Formula | C16H30ClNOSi |
| Molecular Weight | 315.96 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | tert-butyl-(5-chloro-4-pyrrolidin-1-ylcyclohex-3-en-1-yl)oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC=C(N2CCCC2)C(Cl)C1 |
| InChI | InChI=1S/C16H30ClNOSi/c1-16(2,3)20(4,5)19-13-8-9-15(14(17)12-13)18-10-6-7-11-18/h9,13-14H,6-8,10-12H2,1-5H3 |
| InChIKey | ZITSAUHYJIHREL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.96 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|