C19H38O2Si — CID 10991033
(1S,6R)-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxybutyl]-1,5,5-trimethylcyclohex-2-en-1-ol (PubChem CID 10991033) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is (1S,6R)-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxybutyl]-1,5,5-trimethylcyclohex-2-en-1-ol.
| Compound Name | (1S,6R)-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxybutyl]-1,5,5-trimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10991033 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (1S,6R)-6-[(3S)-3-[tert-butyl(dimethyl)silyl]oxybutyl]-1,5,5-trimethylcyclohex-2-en-1-ol |
| SMILES | C[C@@H](CC[C@@H]1C(C)(C)CC=C[C@]1(C)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O2Si/c1-15(21-22(8,9)17(2,3)4)11-12-16-18(5,6)13-10-14-19(16,7)20/h10,14-16,20H,11-13H2,1-9H3/t15-,16+,19-/m0/s1 |
| InChIKey | WNGSPFIQTCBFLP-FCEWJHQRSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|