C16H30O2Si — CID 135037816
(1R,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol (PubChem CID 135037816) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is (1R,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol.
| Compound Name | (1R,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol |
|---|---|
| PubChem CID | 135037816 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (1R,5S,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol |
| SMILES | CC1(O)C=C[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C2(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-14(2,3)19(7,8)18-12-11-9-10-16(6,17)13(12)15(11,4)5/h9-13,17H,1-8H3/t11-,12-,13+,16?/m1/s1 |
| InChIKey | ZXMWCTBNVAZXCH-ABUXHAGHSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|