C24H23N7O3 — CID 10994142
ethyl 2-[4-[7-amino-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]phenoxy]acetate (PubChem CID 10994142) has the molecular formula C24H23N7O3 and a molecular weight of 457.49 g/mol. Its IUPAC name is ethyl 2-[4-[7-amino-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[7-amino-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 10994142 |
| Molecular Formula | C24H23N7O3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | ethyl 2-[4-[7-amino-10-(2-phenylethyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-c2nc3c4cnn(CCc5ccccc5)c4nc(N)n3n2)cc1 |
| InChI | InChI=1S/C24H23N7O3/c1-2-33-20(32)15-34-18-10-8-17(9-11-18)21-27-23-19-14-26-30(13-12-16-6-4-3-5-7-16)22(19)28-24(25)31(23)29-21/h3-11,14H,2,12-13,15H2,1H3,(H2,25,28) |
| InChIKey | QXUUJXYXTIKCSF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |