C36H36N4 — CID 10994977
(4R,9R,23R,28R)-3,10,22,29-tetrazaheptacyclo[29.7.1.112,20.04,9.013,19.023,28.032,38]tetraconta-1(39),2,10,12(40),13,15,17,19,21,29,31,33,35,37-tetradecaene (PubChem CID 10994977) has the molecular formula C36H36N4 and a molecular weight of 524.71 g/mol. Its IUPAC name is (4R,9R,23R,28R)-3,10,22,29-tetrazaheptacyclo[29.7.1.112,20.04,9.013,19.023,28.032,38]tetraconta-1(39),2,10,12(40),13,15,17,19,21,29,31,33,35,37-tetradecaene.
| Compound Name | (4R,9R,23R,28R)-3,10,22,29-tetrazaheptacyclo[29.7.1.112,20.04,9.013,19.023,28.032,38]tetraconta-1(39),2,10,12(40),13,15,17,19,21,29,31,33,35,37-tetradecaene |
|---|---|
| PubChem CID | 10994977 |
| Molecular Formula | C36H36N4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | (4R,9R,23R,28R)-3,10,22,29-tetrazaheptacyclo[29.7.1.112,20.04,9.013,19.023,28.032,38]tetraconta-1(39),2,10,12(40),13,15,17,19,21,29,31,33,35,37-tetradecaene |
| SMILES | C1=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(c3cccccc2-3)/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc/1c1cccccc2-1 |
| InChI | InChI=1S/C36H36N4/c1-3-11-29-25-19-26(30(29)12-4-1)22-38-34-16-8-10-18-36(34)40-24-28-20-27(31-13-5-2-6-14-32(28)31)23-39-35-17-9-7-15-33(35)37-21-25/h1-6,11-14,19-24,33-36H,7-10,15-18H2/b37-21+,38-22+,39-23+,40-24+/t33-,34-,35-,36-/m1/s1 |
| InChIKey | QZBVKLBRQYAKOZ-GTAGPPIUSA-N |
| XLogP | 7.91 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |