C34H34N4O4 — CID 10995319
(5R,6R,7S,8S)-6,7,8-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine (PubChem CID 10995319) has the molecular formula C34H34N4O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is (5R,6R,7S,8S)-6,7,8-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine.
| Compound Name | (5R,6R,7S,8S)-6,7,8-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 10995319 |
| Molecular Formula | C34H34N4O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (5R,6R,7S,8S)-6,7,8-tris(phenylmethoxy)-5-(phenylmethoxymethyl)-5,6,7,8-tetrahydrotetrazolo[1,5-a]pyridine |
| SMILES | c1ccc(COC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)c3nnnn32)cc1 |
| InChI | InChI=1S/C34H34N4O4/c1-5-13-26(14-6-1)21-39-25-30-31(40-22-27-15-7-2-8-16-27)32(41-23-28-17-9-3-10-18-28)33(34-35-36-37-38(30)34)42-24-29-19-11-4-12-20-29/h1-20,30-33H,21-25H2/t30-,31-,32+,33-/m1/s1 |
| InChIKey | OKFWHUNZJSAYLW-NXVJRICRSA-N |
| XLogP | 5.87 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |