C18H35IN4O3 — CID 110029185
tert-butyl 3-(4-propan-2-yloxybutylamino)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazine-7-carboxylate;hydroiodide (PubChem CID 110029185) has the molecular formula C18H35IN4O3 and a molecular weight of 482.41 g/mol. Its IUPAC name is tert-butyl 3-(4-propan-2-yloxybutylamino)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazine-7-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-(4-propan-2-yloxybutylamino)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazine-7-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110029185 |
| Molecular Formula | C18H35IN4O3 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | tert-butyl 3-(4-propan-2-yloxybutylamino)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazine-7-carboxylate;hydroiodide |
| SMILES | CC(C)OCCCCNC1=NCC2CN(C(=O)OC(C)(C)C)CCN12.I |
| InChI | InChI=1S/C18H34N4O3.HI/c1-14(2)24-11-7-6-8-19-16-20-12-15-13-21(9-10-22(15)16)17(23)25-18(3,4)5;/h14-15H,6-13H2,1-5H3,(H,19,20);1H |
| InChIKey | FWXGYQIFRKXWBD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|