C20H35N5O3 — CID 110038037
2-[[(cyclopentylamino)-[4-(morpholine-4-carbonyl)piperidin-1-yl]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110038037) has the molecular formula C20H35N5O3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[[(cyclopentylamino)-[4-(morpholine-4-carbonyl)piperidin-1-yl]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclopentylamino)-[4-(morpholine-4-carbonyl)piperidin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110038037 |
| Molecular Formula | C20H35N5O3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 2-[[(cyclopentylamino)-[4-(morpholine-4-carbonyl)piperidin-1-yl]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCCC1)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C20H35N5O3/c1-23(2)18(26)15-21-20(22-17-5-3-4-6-17)25-9-7-16(8-10-25)19(27)24-11-13-28-14-12-24/h16-17H,3-15H2,1-2H3,(H,21,22) |
| InChIKey | BIEITBUSFCBBSC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|