C24H23NO3Si — CID 11003925
(3R,3aS,4S)-4-methyl-3,6,6-triphenyl-3,3a,4,8-tetrahydro-[1,3,2]dioxasilepino[5,6-c][1,2]oxazole (PubChem CID 11003925) has the molecular formula C24H23NO3Si and a molecular weight of 401.54 g/mol. Its IUPAC name is (3R,3aS,4S)-4-methyl-3,6,6-triphenyl-3,3a,4,8-tetrahydro-[1,3,2]dioxasilepino[5,6-c][1,2]oxazole.
| Compound Name | (3R,3aS,4S)-4-methyl-3,6,6-triphenyl-3,3a,4,8-tetrahydro-[1,3,2]dioxasilepino[5,6-c][1,2]oxazole |
|---|---|
| PubChem CID | 11003925 |
| Molecular Formula | C24H23NO3Si |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (3R,3aS,4S)-4-methyl-3,6,6-triphenyl-3,3a,4,8-tetrahydro-[1,3,2]dioxasilepino[5,6-c][1,2]oxazole |
| SMILES | C[C@@H]1O[Si](c2ccccc2)(c2ccccc2)OCC2=NO[C@@H](c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C24H23NO3Si/c1-18-23-22(25-27-24(23)19-11-5-2-6-12-19)17-26-29(28-18,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,18,23-24H,17H2,1H3/t18-,23-,24-/m0/s1 |
| InChIKey | UCCBGXPFDLTYCN-NWVWQQAFSA-N |
| XLogP | 3.42 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|