C16H23IO7S — CID 11005418
3-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(iodomethyl)oxan-2-yl]propyl 4-methylbenzenesulfonate (PubChem CID 11005418) has the molecular formula C16H23IO7S and a molecular weight of 486.32 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(iodomethyl)oxan-2-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(iodomethyl)oxan-2-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11005418 |
| Molecular Formula | C16H23IO7S |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 3-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(iodomethyl)oxan-2-yl]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@@H]2O[C@H](CI)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C16H23IO7S/c1-10-4-6-11(7-5-10)25(21,22)23-8-2-3-12-14(18)16(20)15(19)13(9-17)24-12/h4-7,12-16,18-20H,2-3,8-9H2,1H3/t12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | ZEAAWZMXYKQLDM-ZVDSWSACSA-N |
| XLogP | 0.77 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|