C44H56Si2 — CID 11006763
6-[(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-5-(6-trimethylsilylhexa-1,5-diynyl)pyren-4-yl]hexa-1,5-diynyl-trimethylsilane (PubChem CID 11006763) has the molecular formula C44H56Si2 and a molecular weight of 641.10 g/mol. Its IUPAC name is 6-[(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-5-(6-trimethylsilylhexa-1,5-diynyl)pyren-4-yl]hexa-1,5-diynyl-trimethylsilane.
| Compound Name | 6-[(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-5-(6-trimethylsilylhexa-1,5-diynyl)pyren-4-yl]hexa-1,5-diynyl-trimethylsilane |
|---|---|
| PubChem CID | 11006763 |
| Molecular Formula | C44H56Si2 |
| Molecular Weight | 641.10 g/mol |
| Exact Mass | 640.39 |
| IUPAC Name | 6-[(10bS,10cS)-2,7-ditert-butyl-10b,10c-dimethyl-5-(6-trimethylsilylhexa-1,5-diynyl)pyren-4-yl]hexa-1,5-diynyl-trimethylsilane |
| SMILES | CC(C)(C)C1=CC2=C(C#CCCC#C[Si](C)(C)C)C(C#CCCC#C[Si](C)(C)C)=C3C=C(C(C)(C)C)C=C4C=CC(=C1)[C@]2(C)[C@@]43C |
| InChI | InChI=1S/C44H56Si2/c1-41(2,3)35-29-33-25-26-34-30-36(42(4,5)6)32-40-38(24-20-16-18-22-28-46(12,13)14)37(23-19-15-17-21-27-45(9,10)11)39(31-35)43(33,7)44(34,40)8/h25-26,29-32H,15-18H2,1-14H3/t43-,44-/m0/s1 |
| InChIKey | FUBNRQQHMSTTAF-CXNSMIOJSA-N |
| XLogP | 11.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.10 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|