C30H41N3O3 — CID 110073004
1-[3-[(3,4-dimethylphenyl)methyl]-18-(2-methoxyacetyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one (PubChem CID 110073004) has the molecular formula C30H41N3O3 and a molecular weight of 491.68 g/mol. Its IUPAC name is 1-[3-[(3,4-dimethylphenyl)methyl]-18-(2-methoxyacetyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one.
| Compound Name | 1-[3-[(3,4-dimethylphenyl)methyl]-18-(2-methoxyacetyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 110073004 |
| Molecular Formula | C30H41N3O3 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | 1-[3-[(3,4-dimethylphenyl)methyl]-18-(2-methoxyacetyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC2CCCC(CN(Cc3ccc(C)c(C)c3)Cc3ccccc31)N2C(=O)COC |
| InChI | InChI=1S/C30H41N3O3/c1-5-29(34)32-16-15-26-10-8-11-27(33(26)30(35)21-36-4)20-31(19-25-9-6-7-12-28(25)32)18-24-14-13-22(2)23(3)17-24/h6-7,9,12-14,17,26-27H,5,8,10-11,15-16,18-21H2,1-4H3 |
| InChIKey | GBNDNLYRIYICFE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |