C14H23NO6SSi — CID 11013873
(3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2'-sulfanylidenespiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one (PubChem CID 11013873) has the molecular formula C14H23NO6SSi and a molecular weight of 361.49 g/mol. Its IUPAC name is (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2'-sulfanylidenespiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one.
| Compound Name | (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2'-sulfanylidenespiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one |
|---|---|
| PubChem CID | 11013873 |
| Molecular Formula | C14H23NO6SSi |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2'-sulfanylidenespiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H]2OC(=S)O[C@@H]2CO[C@]12CNC(=O)O2 |
| InChI | InChI=1S/C14H23NO6SSi/c1-13(2,3)23(4,5)21-10-9-8(18-12(22)19-9)6-17-14(10)7-15-11(16)20-14/h8-10H,6-7H2,1-5H3,(H,15,16)/t8-,9-,10+,14+/m1/s1 |
| InChIKey | YYUDIBPMMLCVNE-RBQUTUCGSA-N |
| XLogP | 1.91 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|