C21H36O5Si — CID 11014778
(1S,2S,5S,6S,9S,10R,12S,13S)-10-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-5,9,13-trimethyl-3,14-dioxatetracyclo[7.5.0.01,13.02,6]tetradecan-4-one (PubChem CID 11014778) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is (1S,2S,5S,6S,9S,10R,12S,13S)-10-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-5,9,13-trimethyl-3,14-dioxatetracyclo[7.5.0.01,13.02,6]tetradecan-4-one.
| Compound Name | (1S,2S,5S,6S,9S,10R,12S,13S)-10-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-5,9,13-trimethyl-3,14-dioxatetracyclo[7.5.0.01,13.02,6]tetradecan-4-one |
|---|---|
| PubChem CID | 11014778 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (1S,2S,5S,6S,9S,10R,12S,13S)-10-[tert-butyl(dimethyl)silyl]oxy-12-hydroxy-5,9,13-trimethyl-3,14-dioxatetracyclo[7.5.0.01,13.02,6]tetradecan-4-one |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@H]1CC[C@@]1(C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@]3(C)O[C@]213 |
| InChI | InChI=1S/C21H36O5Si/c1-12-13-9-10-19(5)15(25-27(7,8)18(2,3)4)11-14(22)20(6)21(19,26-20)16(13)24-17(12)23/h12-16,22H,9-11H2,1-8H3/t12-,13-,14-,15+,16-,19-,20-,21+/m0/s1 |
| InChIKey | MMTAALKMBIIYTM-LYEGGWQISA-N |
| XLogP | 3.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|