C22H40O5Si — CID 162402327
6-(hydroxymethyl)-5a,9b-dimethyl-7-triethylsilyloxy-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-2-carboxylic acid (PubChem CID 162402327) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is 6-(hydroxymethyl)-5a,9b-dimethyl-7-triethylsilyloxy-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-2-carboxylic acid.
| Compound Name | 6-(hydroxymethyl)-5a,9b-dimethyl-7-triethylsilyloxy-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 162402327 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 6-(hydroxymethyl)-5a,9b-dimethyl-7-triethylsilyloxy-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-2-carboxylic acid |
| SMILES | CC[Si](CC)(CC)OC1CCC2C3(C)CC(C(=O)O)OC3CCC2(C)C1CO |
| InChI | InChI=1S/C22H40O5Si/c1-6-28(7-2,8-3)27-16-9-10-18-21(4,15(16)14-23)12-11-19-22(18,5)13-17(26-19)20(24)25/h15-19,23H,6-14H2,1-5H3,(H,24,25) |
| InChIKey | TUXWFJXMRUCSQH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|