C24H28O5S — CID 11015479
(6S)-4-(benzenesulfonyl)-5-ethenyl-2-ethyl-6-(2-phenylmethoxyethyl)oxan-3-one (PubChem CID 11015479) has the molecular formula C24H28O5S and a molecular weight of 428.55 g/mol. Its IUPAC name is (6S)-4-(benzenesulfonyl)-5-ethenyl-2-ethyl-6-(2-phenylmethoxyethyl)oxan-3-one.
| Compound Name | (6S)-4-(benzenesulfonyl)-5-ethenyl-2-ethyl-6-(2-phenylmethoxyethyl)oxan-3-one |
|---|---|
| PubChem CID | 11015479 |
| Molecular Formula | C24H28O5S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (6S)-4-(benzenesulfonyl)-5-ethenyl-2-ethyl-6-(2-phenylmethoxyethyl)oxan-3-one |
| SMILES | C=CC1C(S(=O)(=O)c2ccccc2)C(=O)C(CC)O[C@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C24H28O5S/c1-3-20-22(15-16-28-17-18-11-7-5-8-12-18)29-21(4-2)23(25)24(20)30(26,27)19-13-9-6-10-14-19/h3,5-14,20-22,24H,1,4,15-17H2,2H3/t20?,21?,22-,24?/m0/s1 |
| InChIKey | AKQCXPXVWLPSQQ-VXFBARJMSA-N |
| XLogP | 3.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|