C31H54O4Si — CID 11016757
tert-butyl-[(E,2S,5S,8R)-2-[(2R,3S,5R)-5-[(1S)-1-methoxyethyl]-3-methyloxolan-2-yl]-8-methyl-9-phenylmethoxynon-3-en-5-yl]oxy-dimethylsilane (PubChem CID 11016757) has the molecular formula C31H54O4Si and a molecular weight of 518.86 g/mol. Its IUPAC name is tert-butyl-[(E,2S,5S,8R)-2-[(2R,3S,5R)-5-[(1S)-1-methoxyethyl]-3-methyloxolan-2-yl]-8-methyl-9-phenylmethoxynon-3-en-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,5S,8R)-2-[(2R,3S,5R)-5-[(1S)-1-methoxyethyl]-3-methyloxolan-2-yl]-8-methyl-9-phenylmethoxynon-3-en-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11016757 |
| Molecular Formula | C31H54O4Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | tert-butyl-[(E,2S,5S,8R)-2-[(2R,3S,5R)-5-[(1S)-1-methoxyethyl]-3-methyloxolan-2-yl]-8-methyl-9-phenylmethoxynon-3-en-5-yl]oxy-dimethylsilane |
| SMILES | CO[C@@H](C)[C@H]1C[C@H](C)[C@H]([C@@H](C)/C=C/[C@H](CC[C@@H](C)COCc2ccccc2)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H54O4Si/c1-23(21-33-22-27-14-12-11-13-15-27)16-18-28(35-36(9,10)31(5,6)7)19-17-24(2)30-25(3)20-29(34-30)26(4)32-8/h11-15,17,19,23-26,28-30H,16,18,20-22H2,1-10H3/b19-17+/t23-,24+,25+,26+,28+,29-,30+/m1/s1 |
| InChIKey | UDELXSGAORISPR-ROEWDUNNSA-N |
| XLogP | 8.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|