C32H47NO7Si — CID 11017369
(4S)-4-benzyl-3-[(2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2-methylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 11017369) has the molecular formula C32H47NO7Si and a molecular weight of 585.81 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2-methylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2-methylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11017369 |
| Molecular Formula | C32H47NO7Si |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-2-methylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(COCC[C@H](C[C@@H](O)[C@H](C)C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H47NO7Si/c1-23(30(35)33-26(22-39-31(33)36)19-24-11-9-8-10-12-24)29(34)20-28(40-41(6,7)32(2,3)4)17-18-38-21-25-13-15-27(37-5)16-14-25/h8-16,23,26,28-29,34H,17-22H2,1-7H3/t23-,26-,28+,29+/m0/s1 |
| InChIKey | PBFYVZJZAUARMM-NYXJJKRYSA-N |
| XLogP | 5.97 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|