C25H26N8O2 — CID 110175625
1,3-dimethyl-6,8-bis(2-phenylethylamino)purino[7,8-a][1,3,5]triazine-2,4-dione (PubChem CID 110175625) has the molecular formula C25H26N8O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is 1,3-dimethyl-6,8-bis(2-phenylethylamino)purino[7,8-a][1,3,5]triazine-2,4-dione.
| Compound Name | 1,3-dimethyl-6,8-bis(2-phenylethylamino)purino[7,8-a][1,3,5]triazine-2,4-dione |
|---|---|
| PubChem CID | 110175625 |
| Molecular Formula | C25H26N8O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1,3-dimethyl-6,8-bis(2-phenylethylamino)purino[7,8-a][1,3,5]triazine-2,4-dione |
| SMILES | Cn1c(=O)c2c(nc3nc(NCCc4ccccc4)nc(NCCc4ccccc4)n32)n(C)c1=O |
| InChI | InChI=1S/C25H26N8O2/c1-31-20-19(21(34)32(2)25(31)35)33-23(27-16-14-18-11-7-4-8-12-18)29-22(30-24(33)28-20)26-15-13-17-9-5-3-6-10-17/h3-12H,13-16H2,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | WTXJAHMEESJLFD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |