C17H20N4O2 — CID 110179492
ethyl N-[2-amino-6-[[(E)-3-phenylprop-2-enyl]amino]-3-pyridinyl]carbamate (PubChem CID 110179492) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl N-[2-amino-6-[[(E)-3-phenylprop-2-enyl]amino]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[2-amino-6-[[(E)-3-phenylprop-2-enyl]amino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110179492 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethyl N-[2-amino-6-[[(E)-3-phenylprop-2-enyl]amino]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NC/C=C/c2ccccc2)nc1N |
| InChI | InChI=1S/C17H20N4O2/c1-2-23-17(22)20-14-10-11-15(21-16(14)18)19-12-6-9-13-7-4-3-5-8-13/h3-11H,2,12H2,1H3,(H,20,22)(H3,18,19,21)/b9-6+ |
| InChIKey | PKVFHVLNFMADLC-RMKNXTFCSA-N |
| XLogP | 3.36 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |