C32H50O7 — CID 110180949
[10-formyl-5,14-dihydroxy-13-methyl-17-(6-oxooxan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate (PubChem CID 110180949) has the molecular formula C32H50O7 and a molecular weight of 546.75 g/mol. Its IUPAC name is [10-formyl-5,14-dihydroxy-13-methyl-17-(6-oxooxan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate.
| Compound Name | [10-formyl-5,14-dihydroxy-13-methyl-17-(6-oxooxan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate |
|---|---|
| PubChem CID | 110180949 |
| Molecular Formula | C32H50O7 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | [10-formyl-5,14-dihydroxy-13-methyl-17-(6-oxooxan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1CCC2(C=O)C3CCC4(C)C(C5CCC(=O)OC5)CCC4(O)C3CCC2(O)C1 |
| InChI | InChI=1S/C32H50O7/c1-3-4-5-6-7-8-28(35)39-23-11-16-30(21-33)25-12-15-29(2)24(22-9-10-27(34)38-20-22)14-18-32(29,37)26(25)13-17-31(30,36)19-23/h21-26,36-37H,3-20H2,1-2H3 |
| InChIKey | BYHXLIHROVQJJU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|