C17H21NO2S2 — CID 110182850
3-[4-[di(thiophen-3-yl)methylidene]piperidin-1-yl]propane-1,2-diol (PubChem CID 110182850) has the molecular formula C17H21NO2S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 3-[4-[di(thiophen-3-yl)methylidene]piperidin-1-yl]propane-1,2-diol.
| Compound Name | 3-[4-[di(thiophen-3-yl)methylidene]piperidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 110182850 |
| Molecular Formula | C17H21NO2S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-[4-[di(thiophen-3-yl)methylidene]piperidin-1-yl]propane-1,2-diol |
| SMILES | OCC(O)CN1CCC(=C(c2ccsc2)c2ccsc2)CC1 |
| InChI | InChI=1S/C17H21NO2S2/c19-10-16(20)9-18-5-1-13(2-6-18)17(14-3-7-21-11-14)15-4-8-22-12-15/h3-4,7-8,11-12,16,19-20H,1-2,5-6,9-10H2 |
| InChIKey | SUAWICLZDFDNDD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |