C22H27ClN8O4S4 — CID 110183606
1-[3-[(2-chlorophenyl)-methylsulfamoyl]phenyl]sulfonyl-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methylguanidine (PubChem CID 110183606) has the molecular formula C22H27ClN8O4S4 and a molecular weight of 631.23 g/mol. Its IUPAC name is 1-[3-[(2-chlorophenyl)-methylsulfamoyl]phenyl]sulfonyl-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methylguanidine.
| Compound Name | 1-[3-[(2-chlorophenyl)-methylsulfamoyl]phenyl]sulfonyl-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110183606 |
| Molecular Formula | C22H27ClN8O4S4 |
| Molecular Weight | 631.23 g/mol |
| Exact Mass | 630.07 |
| IUPAC Name | 1-[3-[(2-chlorophenyl)-methylsulfamoyl]phenyl]sulfonyl-3-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCSCc1csc(N=C(N)N)n1)NS(=O)(=O)c1cccc(S(=O)(=O)N(C)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H27ClN8O4S4/c1-26-21(27-10-11-36-13-15-14-37-22(28-15)29-20(24)25)30-38(32,33)16-6-5-7-17(12-16)39(34,35)31(2)19-9-4-3-8-18(19)23/h3-9,12,14H,10-11,13H2,1-2H3,(H2,26,27,30)(H4,24,25,28,29) |
| InChIKey | BQNDWHBVBPFFGM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 185.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|