C17H20Cl2N4O2S2 — CID 54033232
1-(3,4-dichlorophenyl)sulfonyl-2-methyl-3-[2-[(6-methyl-2-pyridinyl)methylsulfanyl]ethyl]guanidine (PubChem CID 54033232) has the molecular formula C17H20Cl2N4O2S2 and a molecular weight of 447.41 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)sulfonyl-2-methyl-3-[2-[(6-methyl-2-pyridinyl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-(3,4-dichlorophenyl)sulfonyl-2-methyl-3-[2-[(6-methyl-2-pyridinyl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 54033232 |
| Molecular Formula | C17H20Cl2N4O2S2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)sulfonyl-2-methyl-3-[2-[(6-methyl-2-pyridinyl)methylsulfanyl]ethyl]guanidine |
| SMILES | C/N=C(\NCCSCc1cccc(C)n1)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H20Cl2N4O2S2/c1-12-4-3-5-13(22-12)11-26-9-8-21-17(20-2)23-27(24,25)14-6-7-15(18)16(19)10-14/h3-7,10H,8-9,11H2,1-2H3,(H2,20,21,23) |
| InChIKey | LHCFFFYONVVFCC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|