C21H27N9O4S4 — CID 110185181
1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methyl-3-[3-(pyridin-2-ylmethylsulfamoyl)phenyl]sulfonylguanidine (PubChem CID 110185181) has the molecular formula C21H27N9O4S4 and a molecular weight of 597.77 g/mol. Its IUPAC name is 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methyl-3-[3-(pyridin-2-ylmethylsulfamoyl)phenyl]sulfonylguanidine.
| Compound Name | 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methyl-3-[3-(pyridin-2-ylmethylsulfamoyl)phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 110185181 |
| Molecular Formula | C21H27N9O4S4 |
| Molecular Weight | 597.77 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | 1-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methyl-3-[3-(pyridin-2-ylmethylsulfamoyl)phenyl]sulfonylguanidine |
| SMILES | C/N=C(\NCCSCc1csc(N=C(N)N)n1)NS(=O)(=O)c1cccc(S(=O)(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C21H27N9O4S4/c1-24-20(26-9-10-35-13-16-14-36-21(28-16)29-19(22)23)30-38(33,34)18-7-4-6-17(11-18)37(31,32)27-12-15-5-2-3-8-25-15/h2-8,11,14,27H,9-10,12-13H2,1H3,(H2,24,26,30)(H4,22,23,28,29) |
| InChIKey | NGSTZEWOAKYRLB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 206.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.77 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|