C19H22N10O4S3 — CID 10554697
1-[2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl]-3-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 10554697) has the molecular formula C19H22N10O4S3 and a molecular weight of 550.65 g/mol. Its IUPAC name is 1-[2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl]-3-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-[2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl]-3-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 10554697 |
| Molecular Formula | C19H22N10O4S3 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 1-[2-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]ethyl]-3-cyano-2-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | N#CN/C(=N\CCSCc1csc(N=C(N)N)n1)NCCOc1nonc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N10O4S3/c20-12-25-18(24-7-9-34-10-13-11-35-19(26-13)27-17(21)22)23-6-8-32-15-16(29-33-28-15)36(30,31)14-4-2-1-3-5-14/h1-5,11H,6-10H2,(H2,23,24,25)(H4,21,22,26,27) |
| InChIKey | PAVFKMXKGGWGPH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 219.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|