C32H38ClN3O6 — CID 110186930
4-[(4-chlorophenyl)methyl]-2-[1-(3-cyclohexyl-3-oxopropyl)azepan-1-ium-4-yl]phthalazin-1-one;2-hydroxy-2-oxoacetate (PubChem CID 110186930) has the molecular formula C32H38ClN3O6 and a molecular weight of 596.12 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-2-[1-(3-cyclohexyl-3-oxopropyl)azepan-1-ium-4-yl]phthalazin-1-one;2-hydroxy-2-oxoacetate.
| Compound Name | 4-[(4-chlorophenyl)methyl]-2-[1-(3-cyclohexyl-3-oxopropyl)azepan-1-ium-4-yl]phthalazin-1-one;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 110186930 |
| Molecular Formula | C32H38ClN3O6 |
| Molecular Weight | 596.12 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-2-[1-(3-cyclohexyl-3-oxopropyl)azepan-1-ium-4-yl]phthalazin-1-one;2-hydroxy-2-oxoacetate |
| SMILES | O=C(CC[NH+]1CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1)C1CCCCC1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C30H36ClN3O2.C2H2O4/c31-24-14-12-22(13-15-24)21-28-26-10-4-5-11-27(26)30(36)34(32-28)25-9-6-18-33(19-16-25)20-17-29(35)23-7-2-1-3-8-23;3-1(4)2(5)6/h4-5,10-15,23,25H,1-3,6-9,16-21H2;(H,3,4)(H,5,6) |
| InChIKey | IGUZWHSNKCVRMP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.12 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|