C20H13F6N5O2 — CID 110191256
(1E)-1-[1-(cyanomethyl)-2-oxo-3-[2-(trifluoromethyl)phenyl]imidazolidin-4-ylidene]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 110191256) has the molecular formula C20H13F6N5O2 and a molecular weight of 469.35 g/mol. Its IUPAC name is (1E)-1-[1-(cyanomethyl)-2-oxo-3-[2-(trifluoromethyl)phenyl]imidazolidin-4-ylidene]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | (1E)-1-[1-(cyanomethyl)-2-oxo-3-[2-(trifluoromethyl)phenyl]imidazolidin-4-ylidene]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 110191256 |
| Molecular Formula | C20H13F6N5O2 |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (1E)-1-[1-(cyanomethyl)-2-oxo-3-[2-(trifluoromethyl)phenyl]imidazolidin-4-ylidene]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | N#CCN1C/C(=N\C(=O)Nc2ccccc2C(F)(F)F)N(c2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C20H13F6N5O2/c21-19(22,23)12-5-1-3-7-14(12)28-17(32)29-16-11-30(10-9-27)18(33)31(16)15-8-4-2-6-13(15)20(24,25)26/h1-8H,10-11H2,(H,28,32)/b29-16+ |
| InChIKey | VMCLLLLSUDLQLC-MUFRIFMGSA-N |
| XLogP | 5.12 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|