C11H21NaO2S3 — CID 110191482
sodium 6,6,8-tris(methylsulfanyl)octanoate (PubChem CID 110191482) has the molecular formula C11H21NaO2S3 and a molecular weight of 304.48 g/mol. Its IUPAC name is sodium 6,6,8-tris(methylsulfanyl)octanoate.
| Compound Name | sodium 6,6,8-tris(methylsulfanyl)octanoate |
|---|---|
| PubChem CID | 110191482 |
| Molecular Formula | C11H21NaO2S3 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | sodium 6,6,8-tris(methylsulfanyl)octanoate |
| SMILES | CSCCC(CCCCC(=O)[O-])(SC)SC.[Na+] |
| InChI | InChI=1S/C11H22O2S3.Na/c1-14-9-8-11(15-2,16-3)7-5-4-6-10(12)13;/h4-9H2,1-3H3,(H,12,13);/q;+1/p-1 |
| InChIKey | KOABPIMBOYPUCN-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|