C18H15N5O3S — CID 110194490
N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-6-(furan-3-yl)-3-nitropyridin-2-amine (PubChem CID 110194490) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-6-(furan-3-yl)-3-nitropyridin-2-amine.
| Compound Name | N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-6-(furan-3-yl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 110194490 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-6-(furan-3-yl)-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccoc2)nc1NCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H15N5O3S/c24-23(25)16-6-5-13(12-7-9-26-11-12)20-17(16)19-8-10-27-18-21-14-3-1-2-4-15(14)22-18/h1-7,9,11H,8,10H2,(H,19,20)(H,21,22) |
| InChIKey | CQHXCEKIZULGQL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|