C15H26O4 — CID 11021962
(3S,3aR,5R,8S,8aS)-8-hydroxy-8-(hydroxymethyl)-5-(2-hydroxypropan-2-yl)-3-methyl-1,3,3a,4,5,6,7,8a-octahydroazulen-2-one (PubChem CID 11021962) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (3S,3aR,5R,8S,8aS)-8-hydroxy-8-(hydroxymethyl)-5-(2-hydroxypropan-2-yl)-3-methyl-1,3,3a,4,5,6,7,8a-octahydroazulen-2-one.
| Compound Name | (3S,3aR,5R,8S,8aS)-8-hydroxy-8-(hydroxymethyl)-5-(2-hydroxypropan-2-yl)-3-methyl-1,3,3a,4,5,6,7,8a-octahydroazulen-2-one |
|---|---|
| PubChem CID | 11021962 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (3S,3aR,5R,8S,8aS)-8-hydroxy-8-(hydroxymethyl)-5-(2-hydroxypropan-2-yl)-3-methyl-1,3,3a,4,5,6,7,8a-octahydroazulen-2-one |
| SMILES | C[C@@H]1C(=O)C[C@H]2[C@H]1C[C@H](C(C)(C)O)CC[C@@]2(O)CO |
| InChI | InChI=1S/C15H26O4/c1-9-11-6-10(14(2,3)18)4-5-15(19,8-16)12(11)7-13(9)17/h9-12,16,18-19H,4-8H2,1-3H3/t9-,10+,11-,12-,15+/m0/s1 |
| InChIKey | GTNUTSUOBZNGSY-NKSTYXRASA-N |
| XLogP | 1.12 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |