C14H21N3O2S — CID 110271425
N-(1,1-dioxothiolan-3-yl)-6-piperidin-4-ylpyridin-2-amine (PubChem CID 110271425) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-6-piperidin-4-ylpyridin-2-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-6-piperidin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 110271425 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-6-piperidin-4-ylpyridin-2-amine |
| SMILES | O=S1(=O)CCC(Nc2cccc(C3CCNCC3)n2)C1 |
| InChI | InChI=1S/C14H21N3O2S/c18-20(19)9-6-12(10-20)16-14-3-1-2-13(17-14)11-4-7-15-8-5-11/h1-3,11-12,15H,4-10H2,(H,16,17) |
| InChIKey | HLPUCVXESWKHAZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |