C38H40N2O3 — CID 11028208
[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] (3S)-2,2-dimethyl-5-oxo-3,5-diphenylpentanoate (PubChem CID 11028208) has the molecular formula C38H40N2O3 and a molecular weight of 572.75 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] (3S)-2,2-dimethyl-5-oxo-3,5-diphenylpentanoate.
| Compound Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] (3S)-2,2-dimethyl-5-oxo-3,5-diphenylpentanoate |
|---|---|
| PubChem CID | 11028208 |
| Molecular Formula | C38H40N2O3 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] (3S)-2,2-dimethyl-5-oxo-3,5-diphenylpentanoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OC(=O)C(C)(C)[C@@H](CC(=O)c1ccccc1)c1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C38H40N2O3/c1-4-26-25-40-22-20-29(26)23-34(40)36(31-19-21-39-33-18-12-11-17-30(31)33)43-37(42)38(2,3)32(27-13-7-5-8-14-27)24-35(41)28-15-9-6-10-16-28/h4-19,21,26,29,32,34,36H,1,20,22-25H2,2-3H3/t26-,29-,32-,34+,36-/m0/s1 |
| InChIKey | ZAJDCYQDCUASTL-XTFGZPQZSA-N |
| XLogP | 7.80 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|