C15H19ClN2O6S — CID 110296154
methyl 4-chloro-3-(3-morpholin-4-ylsulfonylpropanoylamino)benzoate (PubChem CID 110296154) has the molecular formula C15H19ClN2O6S and a molecular weight of 390.85 g/mol. Its IUPAC name is methyl 4-chloro-3-(3-morpholin-4-ylsulfonylpropanoylamino)benzoate.
| Compound Name | methyl 4-chloro-3-(3-morpholin-4-ylsulfonylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 110296154 |
| Molecular Formula | C15H19ClN2O6S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl 4-chloro-3-(3-morpholin-4-ylsulfonylpropanoylamino)benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CCS(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H19ClN2O6S/c1-23-15(20)11-2-3-12(16)13(10-11)17-14(19)4-9-25(21,22)18-5-7-24-8-6-18/h2-3,10H,4-9H2,1H3,(H,17,19) |
| InChIKey | ZLVQBXFZYWZTGX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |