C28H58O5Si2 — CID 11038741
(2S,3R,4S)-4-[(2R,4R,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]-2-methyl-3-triethylsilyloxypentanal (PubChem CID 11038741) has the molecular formula C28H58O5Si2 and a molecular weight of 530.94 g/mol. Its IUPAC name is (2S,3R,4S)-4-[(2R,4R,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]-2-methyl-3-triethylsilyloxypentanal.
| Compound Name | (2S,3R,4S)-4-[(2R,4R,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]-2-methyl-3-triethylsilyloxypentanal |
|---|---|
| PubChem CID | 11038741 |
| Molecular Formula | C28H58O5Si2 |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 530.38 |
| IUPAC Name | (2S,3R,4S)-4-[(2R,4R,5R,6R)-2-methoxy-5-methyl-6-propan-2-yl-4-triethylsilyloxyoxan-2-yl]-2-methyl-3-triethylsilyloxypentanal |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H](C)C=O)[C@H](C)[C@@]1(OC)C[C@@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C28H58O5Si2/c1-13-34(14-2,15-3)32-25-19-28(30-12,31-26(21(7)8)23(25)10)24(11)27(22(9)20-29)33-35(16-4,17-5)18-6/h20-27H,13-19H2,1-12H3/t22-,23+,24+,25-,26-,27-,28-/m1/s1 |
| InChIKey | IURMOVGPFGOSMG-GEMDHXORSA-N |
| XLogP | 7.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|