C14H23N5 — CID 110430337
N-(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 110430337) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 110430337 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-(2,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | Cc1nc(NCCCCN(C)C)c2cc(C)[nH]c2n1 |
| InChI | InChI=1S/C14H23N5/c1-10-9-12-13(15-7-5-6-8-19(3)4)17-11(2)18-14(12)16-10/h9H,5-8H2,1-4H3,(H2,15,16,17,18) |
| InChIKey | AMRBNHGNQNWSIB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|