C19H23N3O — CID 110443867
1,1-dimethyl-3-[2-(2-phenylethyl)-1,3-dihydroisoindol-5-yl]urea (PubChem CID 110443867) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-(2-phenylethyl)-1,3-dihydroisoindol-5-yl]urea.
| Compound Name | 1,1-dimethyl-3-[2-(2-phenylethyl)-1,3-dihydroisoindol-5-yl]urea |
|---|---|
| PubChem CID | 110443867 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1,1-dimethyl-3-[2-(2-phenylethyl)-1,3-dihydroisoindol-5-yl]urea |
| SMILES | CN(C)C(=O)Nc1ccc2c(c1)CN(CCc1ccccc1)C2 |
| InChI | InChI=1S/C19H23N3O/c1-21(2)19(23)20-18-9-8-16-13-22(14-17(16)12-18)11-10-15-6-4-3-5-7-15/h3-9,12H,10-11,13-14H2,1-2H3,(H,20,23) |
| InChIKey | AOHYODCHWNKDGG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |