C17H28N4O — CID 110449631
3-(aminomethyl)-N,N-dimethyl-2-(2-morpholin-4-ylethyl)-1,3-dihydroisoindol-5-amine (PubChem CID 110449631) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-dimethyl-2-(2-morpholin-4-ylethyl)-1,3-dihydroisoindol-5-amine.
| Compound Name | 3-(aminomethyl)-N,N-dimethyl-2-(2-morpholin-4-ylethyl)-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 110449631 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 3-(aminomethyl)-N,N-dimethyl-2-(2-morpholin-4-ylethyl)-1,3-dihydroisoindol-5-amine |
| SMILES | CN(C)c1ccc2c(c1)C(CN)N(CCN1CCOCC1)C2 |
| InChI | InChI=1S/C17H28N4O/c1-19(2)15-4-3-14-13-21(17(12-18)16(14)11-15)6-5-20-7-9-22-10-8-20/h3-4,11,17H,5-10,12-13,18H2,1-2H3 |
| InChIKey | FNQQJQHAKULQOO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 44.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|