C12H14N6O — CID 110490897
3-amino-N-[1-(4-aminophenyl)cyclopropyl]-1,2,4-triazole-1-carboxamide (PubChem CID 110490897) has the molecular formula C12H14N6O and a molecular weight of 258.29 g/mol. Its IUPAC name is 3-amino-N-[1-(4-aminophenyl)cyclopropyl]-1,2,4-triazole-1-carboxamide.
| Compound Name | 3-amino-N-[1-(4-aminophenyl)cyclopropyl]-1,2,4-triazole-1-carboxamide |
|---|---|
| PubChem CID | 110490897 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-amino-N-[1-(4-aminophenyl)cyclopropyl]-1,2,4-triazole-1-carboxamide |
| SMILES | Nc1ccc(C2(NC(=O)n3cnc(N)n3)CC2)cc1 |
| InChI | InChI=1S/C12H14N6O/c13-9-3-1-8(2-4-9)12(5-6-12)16-11(19)18-7-15-10(14)17-18/h1-4,7H,5-6,13H2,(H2,14,17)(H,16,19) |
| InChIKey | DRNYNHYPAMSVAE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|