C22H24F3NO10 — CID 11049600
methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-2-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]acetate (PubChem CID 11049600) has the molecular formula C22H24F3NO10 and a molecular weight of 519.43 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-2-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]acetate.
| Compound Name | methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-2-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]acetate |
|---|---|
| PubChem CID | 11049600 |
| Molecular Formula | C22H24F3NO10 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | methyl (2S)-2-[benzyl-(2,2,2-trifluoroacetyl)amino]-2-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]acetate |
| SMILES | COC(=O)[C@H]([C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O)N(Cc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C22H24F3NO10/c1-11(27)33-17-16(36-20(35-13(3)29)18(17)34-12(2)28)15(19(30)32-4)26(21(31)22(23,24)25)10-14-8-6-5-7-9-14/h5-9,15-18,20H,10H2,1-4H3/t15-,16+,17+,18+,20+/m0/s1 |
| InChIKey | WHYHGFMDPUUPGK-VAVNGKDRSA-N |
| XLogP | 1.27 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|