C29H24N6O3S — CID 11049782
11-(benzotriazol-1-yl)-N-(3,4,5-trimethoxyphenyl)-2-thia-9,12-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,9,11,13,15-octaen-10-amine (PubChem CID 11049782) has the molecular formula C29H24N6O3S and a molecular weight of 536.62 g/mol. Its IUPAC name is 11-(benzotriazol-1-yl)-N-(3,4,5-trimethoxyphenyl)-2-thia-9,12-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,9,11,13,15-octaen-10-amine.
| Compound Name | 11-(benzotriazol-1-yl)-N-(3,4,5-trimethoxyphenyl)-2-thia-9,12-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,9,11,13,15-octaen-10-amine |
|---|---|
| PubChem CID | 11049782 |
| Molecular Formula | C29H24N6O3S |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 11-(benzotriazol-1-yl)-N-(3,4,5-trimethoxyphenyl)-2-thia-9,12-diazatricyclo[11.4.0.03,8]heptadeca-1(17),3,5,7,9,11,13,15-octaen-10-amine |
| SMILES | COc1cc(Nc2nc3ccccc3sc3ccccc3nc2-n2nnc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C29H24N6O3S/c1-36-23-16-18(17-24(37-2)27(23)38-3)30-28-29(35-22-13-7-4-10-19(22)33-34-35)32-21-12-6-9-15-26(21)39-25-14-8-5-11-20(25)31-28/h4-17H,1-3H3,(H,30,31)/b32-29+ |
| InChIKey | YAMBDTMLRPWCBI-UUDCSCGESA-N |
| XLogP | 6.47 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |