C24H35N3O3 — CID 110498706
tert-butyl 4-(1-butyl-3-methylindole-2-carbonyl)-1,4-diazepane-1-carboxylate (PubChem CID 110498706) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is tert-butyl 4-(1-butyl-3-methylindole-2-carbonyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(1-butyl-3-methylindole-2-carbonyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110498706 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | tert-butyl 4-(1-butyl-3-methylindole-2-carbonyl)-1,4-diazepane-1-carboxylate |
| SMILES | CCCCn1c(C(=O)N2CCCN(C(=O)OC(C)(C)C)CC2)c(C)c2ccccc21 |
| InChI | InChI=1S/C24H35N3O3/c1-6-7-15-27-20-12-9-8-11-19(20)18(2)21(27)22(28)25-13-10-14-26(17-16-25)23(29)30-24(3,4)5/h8-9,11-12H,6-7,10,13-17H2,1-5H3 |
| InChIKey | QCCTZKUQASOUDC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|